C27H39NO5S2 — CID 98160253
(2S,3S)-2-[(5E)-5-[[3-ethoxy-4-[(2R)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid (PubChem CID 98160253) has the molecular formula C27H39NO5S2 and a molecular weight of 521.75 g/mol. Its IUPAC name is (2S,3S)-2-[(5E)-5-[[3-ethoxy-4-[(2R)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[(5E)-5-[[3-ethoxy-4-[(2R)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 98160253 |
| Molecular Formula | C27H39NO5S2 |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (2S,3S)-2-[(5E)-5-[[3-ethoxy-4-[(2R)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
| SMILES | CCCCCCC[C@@H](C)Oc1ccc(/C=C2/SC(=S)N([C@H](C(=O)O)[C@@H](C)CC)C2=O)cc1OCC |
| InChI | InChI=1S/C27H39NO5S2/c1-6-9-10-11-12-13-19(5)33-21-15-14-20(16-22(21)32-8-3)17-23-25(29)28(27(34)35-23)24(26(30)31)18(4)7-2/h14-19,24H,6-13H2,1-5H3,(H,30,31)/b23-17+/t18-,19+,24-/m0/s1 |
| InChIKey | NGLYQGARJIWYFC-ZPMJZHRGSA-N |
| XLogP | 6.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|