C24H33NO4S2 — CID 98160095
(2R,3R)-3-methyl-2-[(5E)-5-[(4-octoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid (PubChem CID 98160095) has the molecular formula C24H33NO4S2 and a molecular weight of 463.67 g/mol. Its IUPAC name is (2R,3R)-3-methyl-2-[(5E)-5-[(4-octoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid.
| Compound Name | (2R,3R)-3-methyl-2-[(5E)-5-[(4-octoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 98160095 |
| Molecular Formula | C24H33NO4S2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (2R,3R)-3-methyl-2-[(5E)-5-[(4-octoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
| SMILES | CCCCCCCCOc1ccc(/C=C2/SC(=S)N([C@@H](C(=O)O)[C@H](C)CC)C2=O)cc1 |
| InChI | InChI=1S/C24H33NO4S2/c1-4-6-7-8-9-10-15-29-19-13-11-18(12-14-19)16-20-22(26)25(24(30)31-20)21(23(27)28)17(3)5-2/h11-14,16-17,21H,4-10,15H2,1-3H3,(H,27,28)/b20-16+/t17-,21-/m1/s1 |
| InChIKey | TVGBEGBNYIJFAJ-ZCIDVOINSA-N |
| XLogP | 6.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|