C25H35NO5S2 — CID 98160149
(2R)-2-[(5E)-5-[[3-methoxy-4-[(2S)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid (PubChem CID 98160149) has the molecular formula C25H35NO5S2 and a molecular weight of 493.69 g/mol. Its IUPAC name is (2R)-2-[(5E)-5-[[3-methoxy-4-[(2S)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(5E)-5-[[3-methoxy-4-[(2S)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 98160149 |
| Molecular Formula | C25H35NO5S2 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (2R)-2-[(5E)-5-[[3-methoxy-4-[(2S)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid |
| SMILES | CCCCCCC[C@H](C)Oc1ccc(/C=C2/SC(=S)N([C@@H](C(=O)O)C(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C25H35NO5S2/c1-6-7-8-9-10-11-17(4)31-19-13-12-18(14-20(19)30-5)15-21-23(27)26(25(32)33-21)22(16(2)3)24(28)29/h12-17,22H,6-11H2,1-5H3,(H,28,29)/b21-15+/t17-,22+/m0/s1 |
| InChIKey | ORKOCJWKQFMWQK-OXFOMQGGSA-N |
| XLogP | 6.13 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|