C16H12BrNO4 — CID 141359349
7-bromo-4,6-dimethoxy-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one (PubChem CID 141359349) has the molecular formula C16H12BrNO4 and a molecular weight of 362.18 g/mol. Its IUPAC name is 7-bromo-4,6-dimethoxy-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | 7-bromo-4,6-dimethoxy-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 141359349 |
| Molecular Formula | C16H12BrNO4 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 7-bromo-4,6-dimethoxy-2-(pyridin-4-ylmethylidene)-1-benzofuran-3-one |
| SMILES | COc1cc(OC)c2c(c1Br)OC(=Cc1ccncc1)C2=O |
| InChI | InChI=1S/C16H12BrNO4/c1-20-10-8-11(21-2)14(17)16-13(10)15(19)12(22-16)7-9-3-5-18-6-4-9/h3-8H,1-2H3 |
| InChIKey | GKYIFOFJNJIWTC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|