C26H17F5O6 — CID 95397824
[(2Z)-2-[(2-ethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate (PubChem CID 95397824) has the molecular formula C26H17F5O6 and a molecular weight of 520.41 g/mol. Its IUPAC name is [(2Z)-2-[(2-ethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate.
| Compound Name | [(2Z)-2-[(2-ethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate |
|---|---|
| PubChem CID | 95397824 |
| Molecular Formula | C26H17F5O6 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | [(2Z)-2-[(2-ethoxyphenyl)methylidene]-7-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate |
| SMILES | CCOc1ccccc1/C=C1\Oc2c(ccc(OC(=O)COc3c(F)c(F)c(F)c(F)c3F)c2C)C1=O |
| InChI | InChI=1S/C26H17F5O6/c1-3-34-16-7-5-4-6-13(16)10-17-24(33)14-8-9-15(12(2)25(14)37-17)36-18(32)11-35-26-22(30)20(28)19(27)21(29)23(26)31/h4-10H,3,11H2,1-2H3/b17-10- |
| InChIKey | LXQGEGILUSJCRN-YVLHZVERSA-N |
| XLogP | 5.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|