C24H16Br2O4 — CID 95398687
(2Z)-2-[(2-bromophenyl)methylidene]-6-[2-(4-bromophenyl)-2-oxoethoxy]-7-methyl-1-benzofuran-3-one (PubChem CID 95398687) has the molecular formula C24H16Br2O4 and a molecular weight of 528.20 g/mol. Its IUPAC name is (2Z)-2-[(2-bromophenyl)methylidene]-6-[2-(4-bromophenyl)-2-oxoethoxy]-7-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(2-bromophenyl)methylidene]-6-[2-(4-bromophenyl)-2-oxoethoxy]-7-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 95398687 |
| Molecular Formula | C24H16Br2O4 |
| Molecular Weight | 528.20 g/mol |
| Exact Mass | 525.94 |
| IUPAC Name | (2Z)-2-[(2-bromophenyl)methylidene]-6-[2-(4-bromophenyl)-2-oxoethoxy]-7-methyl-1-benzofuran-3-one |
| SMILES | Cc1c(OCC(=O)c2ccc(Br)cc2)ccc2c1O/C(=C\c1ccccc1Br)C2=O |
| InChI | InChI=1S/C24H16Br2O4/c1-14-21(29-13-20(27)15-6-8-17(25)9-7-15)11-10-18-23(28)22(30-24(14)18)12-16-4-2-3-5-19(16)26/h2-12H,13H2,1H3/b22-12- |
| InChIKey | SIXSKFJEELMDHO-UUYOSTAYSA-N |
| XLogP | 6.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.20 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|