C24H26O8 — CID 3640913
tert-butyl 2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetate (PubChem CID 3640913) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is tert-butyl 2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetate.
| Compound Name | tert-butyl 2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 3640913 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | tert-butyl 2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetate |
| SMILES | COc1cc(OC)c(OC)cc1C=C1Oc2cc(OCC(=O)OC(C)(C)C)ccc2C1=O |
| InChI | InChI=1S/C24H26O8/c1-24(2,3)32-22(25)13-30-15-7-8-16-18(11-15)31-21(23(16)26)10-14-9-19(28-5)20(29-6)12-17(14)27-4/h7-12H,13H2,1-6H3 |
| InChIKey | NMVXFXGLSUFVBJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|