C21H18Cl2O5 — CID 3680887
tert-butyl 2-[[2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate (PubChem CID 3680887) has the molecular formula C21H18Cl2O5 and a molecular weight of 421.28 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate.
| Compound Name | tert-butyl 2-[[2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 3680887 |
| Molecular Formula | C21H18Cl2O5 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | tert-butyl 2-[[2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc2c(c1)OC(=Cc1ccc(Cl)c(Cl)c1)C2=O |
| InChI | InChI=1S/C21H18Cl2O5/c1-21(2,3)28-19(24)11-26-13-5-6-14-17(10-13)27-18(20(14)25)9-12-4-7-15(22)16(23)8-12/h4-10H,11H2,1-3H3 |
| InChIKey | DCJTZMAEAGUEHZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|