C16H10Cl2O5S — CID 6177668
[(2Z)-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate (PubChem CID 6177668) has the molecular formula C16H10Cl2O5S and a molecular weight of 385.22 g/mol. Its IUPAC name is [(2Z)-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate.
| Compound Name | [(2Z)-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 6177668 |
| Molecular Formula | C16H10Cl2O5S |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | [(2Z)-2-[(3,4-dichlorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2c(c1)O/C(=C\c1ccc(Cl)c(Cl)c1)C2=O |
| InChI | InChI=1S/C16H10Cl2O5S/c1-24(20,21)23-10-3-4-11-14(8-10)22-15(16(11)19)7-9-2-5-12(17)13(18)6-9/h2-8H,1H3/b15-7- |
| InChIKey | LPRIUIBCILCMGY-CHHVJCJISA-N |
| XLogP | 3.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|