C16H13NO7S — CID 163120653
N-hydroxy-3-[(6-methylsulfonyloxy-3-oxo-1-benzofuran-2-ylidene)methyl]benzeneamine oxide (PubChem CID 163120653) has the molecular formula C16H13NO7S and a molecular weight of 363.35 g/mol. Its IUPAC name is N-hydroxy-3-[(6-methylsulfonyloxy-3-oxo-1-benzofuran-2-ylidene)methyl]benzeneamine oxide.
| Compound Name | N-hydroxy-3-[(6-methylsulfonyloxy-3-oxo-1-benzofuran-2-ylidene)methyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163120653 |
| Molecular Formula | C16H13NO7S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-hydroxy-3-[(6-methylsulfonyloxy-3-oxo-1-benzofuran-2-ylidene)methyl]benzeneamine oxide |
| SMILES | CS(=O)(=O)Oc1ccc2c(c1)OC(=Cc1cccc([NH+]([O-])O)c1)C2=O |
| InChI | InChI=1S/C16H13NO7S/c1-25(21,22)24-12-5-6-13-14(9-12)23-15(16(13)18)8-10-3-2-4-11(7-10)17(19)20/h2-9,17,19H,1H3 |
| InChIKey | BJZONXKJHISMDY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|