C20H13NO7 — CID 163125914
3-[[6-(furan-2-carbonyloxy)-3-oxo-1-benzofuran-2-ylidene]methyl]-N-hydroxybenzeneamine oxide (PubChem CID 163125914) has the molecular formula C20H13NO7 and a molecular weight of 379.32 g/mol. Its IUPAC name is 3-[[6-(furan-2-carbonyloxy)-3-oxo-1-benzofuran-2-ylidene]methyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[[6-(furan-2-carbonyloxy)-3-oxo-1-benzofuran-2-ylidene]methyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163125914 |
| Molecular Formula | C20H13NO7 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-[[6-(furan-2-carbonyloxy)-3-oxo-1-benzofuran-2-ylidene]methyl]-N-hydroxybenzeneamine oxide |
| SMILES | O=C(Oc1ccc2c(c1)OC(=Cc1cccc([NH+]([O-])O)c1)C2=O)c1ccco1 |
| InChI | InChI=1S/C20H13NO7/c22-19-15-7-6-14(27-20(23)16-5-2-8-26-16)11-17(15)28-18(19)10-12-3-1-4-13(9-12)21(24)25/h1-11,21,24H |
| InChIKey | DHASARVNSXQYJI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|