C25H16F5NO6 — CID 95397951
N-[2-(3,4-dimethoxyphenyl)-4-oxochromen-6-yl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide (PubChem CID 95397951) has the molecular formula C25H16F5NO6 and a molecular weight of 521.39 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-4-oxochromen-6-yl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-4-oxochromen-6-yl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 95397951 |
| Molecular Formula | C25H16F5NO6 |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-4-oxochromen-6-yl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide |
| SMILES | COc1ccc(-c2cc(=O)c3cc(NC(=O)COc4c(F)c(F)c(F)c(F)c4F)ccc3o2)cc1OC |
| InChI | InChI=1S/C25H16F5NO6/c1-34-16-5-3-11(7-18(16)35-2)17-9-14(32)13-8-12(4-6-15(13)37-17)31-19(33)10-36-25-23(29)21(27)20(26)22(28)24(25)30/h3-9H,10H2,1-2H3,(H,31,33) |
| InChIKey | AADAHEVWKLYPKA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|