C26H18F5NO5 — CID 110274178
N-[2-(4-ethoxyphenyl)-4-oxochromen-6-yl]-2-(2,3,4,5,6-pentafluorophenoxy)propanamide (PubChem CID 110274178) has the molecular formula C26H18F5NO5 and a molecular weight of 519.42 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenyl)-4-oxochromen-6-yl]-2-(2,3,4,5,6-pentafluorophenoxy)propanamide.
| Compound Name | N-[2-(4-ethoxyphenyl)-4-oxochromen-6-yl]-2-(2,3,4,5,6-pentafluorophenoxy)propanamide |
|---|---|
| PubChem CID | 110274178 |
| Molecular Formula | C26H18F5NO5 |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | N-[2-(4-ethoxyphenyl)-4-oxochromen-6-yl]-2-(2,3,4,5,6-pentafluorophenoxy)propanamide |
| SMILES | CCOc1ccc(-c2cc(=O)c3cc(NC(=O)C(C)Oc4c(F)c(F)c(F)c(F)c4F)ccc3o2)cc1 |
| InChI | InChI=1S/C26H18F5NO5/c1-3-35-15-7-4-13(5-8-15)19-11-17(33)16-10-14(6-9-18(16)37-19)32-26(34)12(2)36-25-23(30)21(28)20(27)22(29)24(25)31/h4-12H,3H2,1-2H3,(H,32,34) |
| InChIKey | UWMCNZCBOCTUJO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|