C23H29NO5 — CID 155565080
1-[4-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butoxy]-2-hydroxyphenyl]ethanone (PubChem CID 155565080) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-[4-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butoxy]-2-hydroxyphenyl]ethanone.
| Compound Name | 1-[4-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butoxy]-2-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 155565080 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-[4-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butoxy]-2-hydroxyphenyl]ethanone |
| SMILES | COc1cc2c(cc1OC)CN(CCCCOc1ccc(C(C)=O)c(O)c1)CC2 |
| InChI | InChI=1S/C23H29NO5/c1-16(25)20-7-6-19(14-21(20)26)29-11-5-4-9-24-10-8-17-12-22(27-2)23(28-3)13-18(17)15-24/h6-7,12-14,26H,4-5,8-11,15H2,1-3H3 |
| InChIKey | GQORNNSDCGMJPS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|