C25H34N2O5 — CID 16737767
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-hydroxyethoxy)-5-methylbenzamide (PubChem CID 16737767) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-hydroxyethoxy)-5-methylbenzamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-hydroxyethoxy)-5-methylbenzamide |
|---|---|
| PubChem CID | 16737767 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-hydroxyethoxy)-5-methylbenzamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCNC(=O)c1cc(C)ccc1OCCO)CC2 |
| InChI | InChI=1S/C25H34N2O5/c1-18-6-7-22(32-13-12-28)21(14-18)25(29)26-9-4-5-10-27-11-8-19-15-23(30-2)24(31-3)16-20(19)17-27/h6-7,14-16,28H,4-5,8-13,17H2,1-3H3,(H,26,29) |
| InChIKey | MWRIBVIDLTUMJN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|