C25H32FIN2O5 — CID 58444227
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-(18F)fluoroethoxy)-3-(hydroxymethyl)-5-iodo(18F)benzamide (PubChem CID 58444227) has the molecular formula C25H32FIN2O5 and a molecular weight of 585.44 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-(18F)fluoroethoxy)-3-(hydroxymethyl)-5-iodo(18F)benzamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-(18F)fluoroethoxy)-3-(hydroxymethyl)-5-iodo(18F)benzamide |
|---|---|
| PubChem CID | 58444227 |
| Molecular Formula | C25H32FIN2O5 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-(18F)fluoroethoxy)-3-(hydroxymethyl)-5-iodo(18F)benzamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCNC(=O)c1cc(I)cc(CO)c1OCC[18F])CC2 |
| InChI | InChI=1S/C25H32FIN2O5/c1-32-22-12-17-5-9-29(15-18(17)13-23(22)33-2)8-4-3-7-28-25(31)21-14-20(27)11-19(16-30)24(21)34-10-6-26/h11-14,30H,3-10,15-16H2,1-2H3,(H,28,31)/i26-1 |
| InChIKey | SXHDPHRUAIMPNV-KPVNRNJOSA-N |
| XLogP | 3.72 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|