C22H27IN2O5 — CID 25184874
N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-5-iodo-2,3-dimethoxybenzamide (PubChem CID 25184874) has the molecular formula C22H27IN2O5 and a molecular weight of 526.37 g/mol. Its IUPAC name is N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-5-iodo-2,3-dimethoxybenzamide.
| Compound Name | N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-5-iodo-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 25184874 |
| Molecular Formula | C22H27IN2O5 |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-5-iodo-2,3-dimethoxybenzamide |
| SMILES | COc1cc2c(cc1OC)CN(CCNC(=O)c1cc(I)cc(OC)c1OC)CC2 |
| InChI | InChI=1S/C22H27IN2O5/c1-27-18-9-14-5-7-25(13-15(14)10-19(18)28-2)8-6-24-22(26)17-11-16(23)12-20(29-3)21(17)30-4/h9-12H,5-8,13H2,1-4H3,(H,24,26) |
| InChIKey | IVEFVNISHAOCQE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|