C36H58N2O5Sn — CID 140876394
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,3-dimethoxy-5-tributylstannylbenzamide (PubChem CID 140876394) has the molecular formula C36H58N2O5Sn and a molecular weight of 717.58 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,3-dimethoxy-5-tributylstannylbenzamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,3-dimethoxy-5-tributylstannylbenzamide |
|---|---|
| PubChem CID | 140876394 |
| Molecular Formula | C36H58N2O5Sn |
| Molecular Weight | 717.58 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,3-dimethoxy-5-tributylstannylbenzamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(OC)c(OC)c(C(=O)NCCCCN2CCc3cc(OC)c(OC)cc3C2)c1 |
| InChI | InChI=1S/C24H31N2O5.3C4H9.Sn/c1-28-20-9-7-8-19(23(20)31-4)24(27)25-11-5-6-12-26-13-10-17-14-21(29-2)22(30-3)15-18(17)16-26;3*1-3-4-2;/h8-9,14-15H,5-6,10-13,16H2,1-4H3,(H,25,27);3*1,3-4H2,2H3; |
| InChIKey | SBVIXTJOUBGUCF-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.58 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|