C24H31IN2O5 — CID 16737928
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-hydroxyethoxy)-5-iodobenzamide (PubChem CID 16737928) has the molecular formula C24H31IN2O5 and a molecular weight of 554.43 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-hydroxyethoxy)-5-iodobenzamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-hydroxyethoxy)-5-iodobenzamide |
|---|---|
| PubChem CID | 16737928 |
| Molecular Formula | C24H31IN2O5 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2-(2-hydroxyethoxy)-5-iodobenzamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCNC(=O)c1cc(I)ccc1OCCO)CC2 |
| InChI | InChI=1S/C24H31IN2O5/c1-30-22-13-17-7-10-27(16-18(17)14-23(22)31-2)9-4-3-8-26-24(29)20-15-19(25)5-6-21(20)32-12-11-28/h5-6,13-15,28H,3-4,7-12,16H2,1-2H3,(H,26,29) |
| InChIKey | RJUWVFREDKFFIR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|