C21H18N2O5 — CID 42933658
3-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-methyl-1-phenylimidazolidine-2,4-dione (PubChem CID 42933658) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 3-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-methyl-1-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-methyl-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42933658 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-methyl-1-phenylimidazolidine-2,4-dione |
| SMILES | COc1ccc2c(CN3C(=O)C(C)N(c4ccccc4)C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H18N2O5/c1-13-20(25)22(21(26)23(13)15-6-4-3-5-7-15)12-14-10-19(24)28-18-11-16(27-2)8-9-17(14)18/h3-11,13H,12H2,1-2H3 |
| InChIKey | ZGOQMUILQBZFHI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|