C17H20ClNO2 — CID 78787562
6-chloro-4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-7-methylchromen-2-one (PubChem CID 78787562) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 6-chloro-4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 78787562 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 6-chloro-4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-7-methylchromen-2-one |
| SMILES | C=C(C)CN(CC)Cc1cc(=O)oc2cc(C)c(Cl)cc12 |
| InChI | InChI=1S/C17H20ClNO2/c1-5-19(9-11(2)3)10-13-7-17(20)21-16-6-12(4)15(18)8-14(13)16/h6-8H,2,5,9-10H2,1,3-4H3 |
| InChIKey | YQJWUVJXNGDZPK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|