C18H21ClN2O5 — CID 8799739
ethyl N-[2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethylamino]acetyl]carbamate (PubChem CID 8799739) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is ethyl N-[2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethylamino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethylamino]acetyl]carbamate |
|---|---|
| PubChem CID | 8799739 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | ethyl N-[2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethylamino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(CC)Cc1cc(=O)oc2cc(C)c(Cl)cc12 |
| InChI | InChI=1S/C18H21ClN2O5/c1-4-21(10-16(22)20-18(24)25-5-2)9-12-7-17(23)26-15-6-11(3)14(19)8-13(12)15/h6-8H,4-5,9-10H2,1-3H3,(H,20,22,24) |
| InChIKey | UNPWHBQUEJMGTA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|