C21H25ClN4O4 — CID 29467659
6-amino-1-butyl-5-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethylamino]pyrimidine-2,4-dione (PubChem CID 29467659) has the molecular formula C21H25ClN4O4 and a molecular weight of 432.91 g/mol. Its IUPAC name is 6-amino-1-butyl-5-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethylamino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethylamino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 29467659 |
| Molecular Formula | C21H25ClN4O4 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 6-amino-1-butyl-5-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethylamino]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(N(CC)Cc2cc(=O)oc3cc(C)c(Cl)cc23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H25ClN4O4/c1-4-6-7-26-19(23)18(20(28)24-21(26)29)25(5-2)11-13-9-17(27)30-16-8-12(3)15(22)10-14(13)16/h8-10H,4-7,11,23H2,1-3H3,(H,24,28,29) |
| InChIKey | RZDXCICTJGDRJQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|