C22H28N4O4 — CID 55499123
6-amino-1-butyl-5-[ethyl-[(7-ethyl-2-oxochromen-4-yl)methyl]amino]pyrimidine-2,4-dione (PubChem CID 55499123) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 6-amino-1-butyl-5-[ethyl-[(7-ethyl-2-oxochromen-4-yl)methyl]amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-[ethyl-[(7-ethyl-2-oxochromen-4-yl)methyl]amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55499123 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 6-amino-1-butyl-5-[ethyl-[(7-ethyl-2-oxochromen-4-yl)methyl]amino]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(N(CC)Cc2cc(=O)oc3cc(CC)ccc23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H28N4O4/c1-4-7-10-26-20(23)19(21(28)24-22(26)29)25(6-3)13-15-12-18(27)30-17-11-14(5-2)8-9-16(15)17/h8-9,11-12H,4-7,10,13,23H2,1-3H3,(H,24,28,29) |
| InChIKey | QRMBHBGLUWNWEQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|