C22H28N4O4 — CID 8838834
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-1-benzofuran-2-carboxamide (PubChem CID 8838834) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8838834 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-1-benzofuran-2-carboxamide |
| SMILES | CCCCCN(C(=O)c1cc2ccccc2o1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H28N4O4/c1-3-5-9-13-25(21(28)17-14-15-10-7-8-11-16(15)30-17)18-19(23)26(12-6-4-2)22(29)24-20(18)27/h7-8,10-11,14H,3-6,9,12-13,23H2,1-2H3,(H,24,27,29) |
| InChIKey | RQTUWIQNDVHWJW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|