C21H27F3N4O3 — CID 26205785
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-2-(trifluoromethyl)benzamide (PubChem CID 26205785) has the molecular formula C21H27F3N4O3 and a molecular weight of 440.47 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-2-(trifluoromethyl)benzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 26205785 |
| Molecular Formula | C21H27F3N4O3 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-2-(trifluoromethyl)benzamide |
| SMILES | CCCCCN(C(=O)c1ccccc1C(F)(F)F)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H27F3N4O3/c1-3-5-9-13-27(19(30)14-10-7-8-11-15(14)21(22,23)24)16-17(25)28(12-6-4-2)20(31)26-18(16)29/h7-8,10-11H,3-6,9,12-13,25H2,1-2H3,(H,26,29,31) |
| InChIKey | LRMNPTXHDZJAPS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|