C23H29N5O4 — CID 55448114
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 55448114) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 55448114 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCN(C(=O)c1cc(-c2ccccc2)on1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H29N5O4/c1-3-5-10-14-27(19-20(24)28(13-6-4-2)23(31)25-21(19)29)22(30)17-15-18(32-26-17)16-11-8-7-9-12-16/h7-9,11-12,15H,3-6,10,13-14,24H2,1-2H3,(H,25,29,31) |
| InChIKey | OBIXHGNKDPCZKO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|