C19H25Cl2N5O3 — CID 26205838
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3,6-dichloro-N-pentylpyridine-2-carboxamide (PubChem CID 26205838) has the molecular formula C19H25Cl2N5O3 and a molecular weight of 442.35 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3,6-dichloro-N-pentylpyridine-2-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3,6-dichloro-N-pentylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 26205838 |
| Molecular Formula | C19H25Cl2N5O3 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3,6-dichloro-N-pentylpyridine-2-carboxamide |
| SMILES | CCCCCN(C(=O)c1nc(Cl)ccc1Cl)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H25Cl2N5O3/c1-3-5-7-11-25(18(28)14-12(20)8-9-13(21)23-14)15-16(22)26(10-6-4-2)19(29)24-17(15)27/h8-9H,3-7,10-11,22H2,1-2H3,(H,24,27,29) |
| InChIKey | ANCCRMZJMSTZEE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|