C16H20ClN5O3 — CID 29309904
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-6-chloro-N-ethylpyridine-3-carboxamide (PubChem CID 29309904) has the molecular formula C16H20ClN5O3 and a molecular weight of 365.82 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-6-chloro-N-ethylpyridine-3-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-6-chloro-N-ethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 29309904 |
| Molecular Formula | C16H20ClN5O3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-6-chloro-N-ethylpyridine-3-carboxamide |
| SMILES | CCCCn1c(N)c(N(CC)C(=O)c2ccc(Cl)nc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H20ClN5O3/c1-3-5-8-22-13(18)12(14(23)20-16(22)25)21(4-2)15(24)10-6-7-11(17)19-9-10/h6-7,9H,3-5,8,18H2,1-2H3,(H,20,23,25) |
| InChIKey | SCCFDPCEVNLDQK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|