C24H30ClN5O3 — CID 55478385
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-6-chloro-2-methyl-N-pentylquinoline-3-carboxamide (PubChem CID 55478385) has the molecular formula C24H30ClN5O3 and a molecular weight of 471.99 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-6-chloro-2-methyl-N-pentylquinoline-3-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-6-chloro-2-methyl-N-pentylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 55478385 |
| Molecular Formula | C24H30ClN5O3 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-6-chloro-2-methyl-N-pentylquinoline-3-carboxamide |
| SMILES | CCCCCN(C(=O)c1cc2cc(Cl)ccc2nc1C)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H30ClN5O3/c1-4-6-8-12-29(20-21(26)30(11-7-5-2)24(33)28-22(20)31)23(32)18-14-16-13-17(25)9-10-19(16)27-15(18)3/h9-10,13-14H,4-8,11-12,26H2,1-3H3,(H,28,31,33) |
| InChIKey | FZCXCSBOVLRERM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|