C23H30N6O3 — CID 30969804
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-4-pyrazol-1-ylbenzamide (PubChem CID 30969804) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-4-pyrazol-1-ylbenzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-4-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 30969804 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-pentyl-4-pyrazol-1-ylbenzamide |
| SMILES | CCCCCN(C(=O)c1ccc(-n2cccn2)cc1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H30N6O3/c1-3-5-7-15-27(19-20(24)28(14-6-4-2)23(32)26-21(19)30)22(31)17-9-11-18(12-10-17)29-16-8-13-25-29/h8-13,16H,3-7,14-15,24H2,1-2H3,(H,26,30,32) |
| InChIKey | XCJIJASNXOXEPI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|