C23H28N4O5 — CID 26185426
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)-2-oxochromene-3-carboxamide (PubChem CID 26185426) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 26185426 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(3-methylbutyl)-2-oxochromene-3-carboxamide |
| SMILES | CCCCn1c(N)c(N(CCC(C)C)C(=O)c2cc3ccccc3oc2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H28N4O5/c1-4-5-11-27-19(24)18(20(28)25-23(27)31)26(12-10-14(2)3)21(29)16-13-15-8-6-7-9-17(15)32-22(16)30/h6-9,13-14H,4-5,10-12,24H2,1-3H3,(H,25,28,31) |
| InChIKey | OPPYMWGWYDTXSS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|