C13H18ClN2O+ — CID 6962116
(3R)-1-[(2-chlorophenyl)methyl]piperidin-1-ium-3-carboxamide (PubChem CID 6962116) has the molecular formula C13H18ClN2O+ and a molecular weight of 253.75 g/mol. Its IUPAC name is (3R)-1-[(2-chlorophenyl)methyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[(2-chlorophenyl)methyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 6962116 |
| Molecular Formula | C13H18ClN2O+ |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3R)-1-[(2-chlorophenyl)methyl]piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[NH+](Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C13H17ClN2O/c14-12-6-2-1-4-10(12)8-16-7-3-5-11(9-16)13(15)17/h1-2,4,6,11H,3,5,7-9H2,(H2,15,17)/p+1/t11-/m1/s1 |
| InChIKey | NXKOLYLUIAMDBK-LLVKDONJSA-O |
| XLogP | 0.62 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |