C17H22ClN4O+ — CID 8545889
(3R)-1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]piperidin-1-ium-3-carboxamide (PubChem CID 8545889) has the molecular formula C17H22ClN4O+ and a molecular weight of 333.84 g/mol. Its IUPAC name is (3R)-1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8545889 |
| Molecular Formula | C17H22ClN4O+ |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3R)-1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]piperidin-1-ium-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C[NH+]1CCC[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C17H21ClN4O/c1-12-15(11-21-9-5-6-13(10-21)17(19)23)16(18)22(20-12)14-7-3-2-4-8-14/h2-4,7-8,13H,5-6,9-11H2,1H3,(H2,19,23)/p+1/t13-/m1/s1 |
| InChIKey | IMKWOEFRMXVGEU-CYBMUJFWSA-O |
| XLogP | 1.11 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |