C21H22ClN5O2 — CID 78851985
(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl 1-pyrazin-2-ylpiperidine-4-carboxylate (PubChem CID 78851985) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl 1-pyrazin-2-ylpiperidine-4-carboxylate.
| Compound Name | (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl 1-pyrazin-2-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 78851985 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl 1-pyrazin-2-ylpiperidine-4-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1COC(=O)C1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C21H22ClN5O2/c1-15-18(20(22)27(25-15)17-5-3-2-4-6-17)14-29-21(28)16-7-11-26(12-8-16)19-13-23-9-10-24-19/h2-6,9-10,13,16H,7-8,11-12,14H2,1H3 |
| InChIKey | UACBVYUBQCFETJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |