C18H30N2+2 — CID 7410070
1-[(2-methylphenyl)methyl]-4-piperidin-1-ium-1-ylpiperidin-1-ium (PubChem CID 7410070) has the molecular formula C18H30N2+2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-4-piperidin-1-ium-1-ylpiperidin-1-ium.
| Compound Name | 1-[(2-methylphenyl)methyl]-4-piperidin-1-ium-1-ylpiperidin-1-ium |
|---|---|
| PubChem CID | 7410070 |
| Molecular Formula | C18H30N2+2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-4-piperidin-1-ium-1-ylpiperidin-1-ium |
| SMILES | Cc1ccccc1C[NH+]1CCC([NH+]2CCCCC2)CC1 |
| InChI | InChI=1S/C18H28N2/c1-16-7-3-4-8-17(16)15-19-13-9-18(10-14-19)20-11-5-2-6-12-20/h3-4,7-8,18H,2,5-6,9-15H2,1H3/p+2 |
| InChIKey | IGYFAJNYPQSNLD-UHFFFAOYSA-P |
| XLogP | 0.61 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |