C17H27BrN2+2 — CID 6937910
1-[(2-bromophenyl)methyl]-4-piperidin-1-ium-1-ylpiperidin-1-ium (PubChem CID 6937910) has the molecular formula C17H27BrN2+2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-4-piperidin-1-ium-1-ylpiperidin-1-ium.
| Compound Name | 1-[(2-bromophenyl)methyl]-4-piperidin-1-ium-1-ylpiperidin-1-ium |
|---|---|
| PubChem CID | 6937910 |
| Molecular Formula | C17H27BrN2+2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-4-piperidin-1-ium-1-ylpiperidin-1-ium |
| SMILES | Brc1ccccc1C[NH+]1CCC([NH+]2CCCCC2)CC1 |
| InChI | InChI=1S/C17H25BrN2/c18-17-7-3-2-6-15(17)14-19-12-8-16(9-13-19)20-10-4-1-5-11-20/h2-3,6-7,16H,1,4-5,8-14H2/p+2 |
| InChIKey | ABMFWSOWVJVGGG-UHFFFAOYSA-P |
| XLogP | 1.07 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |