C15H25N3+2 — CID 7026293
4-[(4-pyrrolidin-1-ium-1-ylpiperidin-1-ium-1-yl)methyl]pyridine (PubChem CID 7026293) has the molecular formula C15H25N3+2 and a molecular weight of 247.39 g/mol. Its IUPAC name is 4-[(4-pyrrolidin-1-ium-1-ylpiperidin-1-ium-1-yl)methyl]pyridine.
| Compound Name | 4-[(4-pyrrolidin-1-ium-1-ylpiperidin-1-ium-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 7026293 |
| Molecular Formula | C15H25N3+2 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 4-[(4-pyrrolidin-1-ium-1-ylpiperidin-1-ium-1-yl)methyl]pyridine |
| SMILES | c1cc(C[NH+]2CCC([NH+]3CCCC3)CC2)ccn1 |
| InChI | InChI=1S/C15H23N3/c1-2-10-18(9-1)15-5-11-17(12-6-15)13-14-3-7-16-8-4-14/h3-4,7-8,15H,1-2,5-6,9-13H2/p+2 |
| InChIKey | XQUUCFFKVKGRIV-UHFFFAOYSA-P |
| XLogP | -0.69 |
| TPSA | 21.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |