C27H36N3O+ — CID 7114273
azepan-1-yl-[(3S)-1-[(9-ethylcarbazol-3-yl)methyl]piperidin-1-ium-3-yl]methanone (PubChem CID 7114273) has the molecular formula C27H36N3O+ and a molecular weight of 418.61 g/mol. Its IUPAC name is azepan-1-yl-[(3S)-1-[(9-ethylcarbazol-3-yl)methyl]piperidin-1-ium-3-yl]methanone.
| Compound Name | azepan-1-yl-[(3S)-1-[(9-ethylcarbazol-3-yl)methyl]piperidin-1-ium-3-yl]methanone |
|---|---|
| PubChem CID | 7114273 |
| Molecular Formula | C27H36N3O+ |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | azepan-1-yl-[(3S)-1-[(9-ethylcarbazol-3-yl)methyl]piperidin-1-ium-3-yl]methanone |
| SMILES | CCn1c2ccccc2c2cc(C[NH+]3CCC[C@H](C(=O)N4CCCCCC4)C3)ccc21 |
| InChI | InChI=1S/C27H35N3O/c1-2-30-25-12-6-5-11-23(25)24-18-21(13-14-26(24)30)19-28-15-9-10-22(20-28)27(31)29-16-7-3-4-8-17-29/h5-6,11-14,18,22H,2-4,7-10,15-17,19-20H2,1H3/p+1/t22-/m0/s1 |
| InChIKey | HXAXUNQVCWXUSI-QFIPXVFZSA-O |
| XLogP | 4.01 |
| TPSA | 29.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |