C25H35N3+2 — CID 7027663
9-ethyl-3-[(4-piperidin-1-ium-1-ylpiperidin-1-ium-1-yl)methyl]carbazole (PubChem CID 7027663) has the molecular formula C25H35N3+2 and a molecular weight of 377.58 g/mol. Its IUPAC name is 9-ethyl-3-[(4-piperidin-1-ium-1-ylpiperidin-1-ium-1-yl)methyl]carbazole.
| Compound Name | 9-ethyl-3-[(4-piperidin-1-ium-1-ylpiperidin-1-ium-1-yl)methyl]carbazole |
|---|---|
| PubChem CID | 7027663 |
| Molecular Formula | C25H35N3+2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 9-ethyl-3-[(4-piperidin-1-ium-1-ylpiperidin-1-ium-1-yl)methyl]carbazole |
| SMILES | CCn1c2ccccc2c2cc(C[NH+]3CCC([NH+]4CCCCC4)CC3)ccc21 |
| InChI | InChI=1S/C25H33N3/c1-2-28-24-9-5-4-8-22(24)23-18-20(10-11-25(23)28)19-26-16-12-21(13-17-26)27-14-6-3-7-15-27/h4-5,8-11,18,21H,2-3,6-7,12-17,19H2,1H3/p+2 |
| InChIKey | ZFQPKJHHMMGQKL-UHFFFAOYSA-P |
| XLogP | 2.43 |
| TPSA | 13.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |