C25H27N4O2+ — CID 7060320
9-ethyl-3-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]carbazole (PubChem CID 7060320) has the molecular formula C25H27N4O2+ and a molecular weight of 415.52 g/mol. Its IUPAC name is 9-ethyl-3-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]carbazole.
| Compound Name | 9-ethyl-3-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]carbazole |
|---|---|
| PubChem CID | 7060320 |
| Molecular Formula | C25H27N4O2+ |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 9-ethyl-3-[[4-(4-nitrophenyl)piperazin-1-ium-1-yl]methyl]carbazole |
| SMILES | CCn1c2ccccc2c2cc(C[NH+]3CCN(c4ccc([N+](=O)[O-])cc4)CC3)ccc21 |
| InChI | InChI=1S/C25H26N4O2/c1-2-28-24-6-4-3-5-22(24)23-17-19(7-12-25(23)28)18-26-13-15-27(16-14-26)20-8-10-21(11-9-20)29(30)31/h3-12,17H,2,13-16,18H2,1H3/p+1 |
| InChIKey | FQJFUVREJPJJFF-UHFFFAOYSA-O |
| XLogP | 3.63 |
| TPSA | 55.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|