C26H27FN3O+ — CID 2165679
[4-[(9-ethylcarbazol-3-yl)methyl]piperazin-4-ium-1-yl]-(3-fluorophenyl)methanone (PubChem CID 2165679) has the molecular formula C26H27FN3O+ and a molecular weight of 416.52 g/mol. Its IUPAC name is [4-[(9-ethylcarbazol-3-yl)methyl]piperazin-4-ium-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [4-[(9-ethylcarbazol-3-yl)methyl]piperazin-4-ium-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 2165679 |
| Molecular Formula | C26H27FN3O+ |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [4-[(9-ethylcarbazol-3-yl)methyl]piperazin-4-ium-1-yl]-(3-fluorophenyl)methanone |
| SMILES | CCn1c2ccccc2c2cc(C[NH+]3CCN(C(=O)c4cccc(F)c4)CC3)ccc21 |
| InChI | InChI=1S/C26H26FN3O/c1-2-30-24-9-4-3-8-22(24)23-16-19(10-11-25(23)30)18-28-12-14-29(15-13-28)26(31)20-6-5-7-21(27)17-20/h3-11,16-17H,2,12-15,18H2,1H3/p+1 |
| InChIKey | BTPNUKYNSXPLND-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 29.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |