C19H19F4N2O+ — CID 4755342
(3-fluorophenyl)-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 4755342) has the molecular formula C19H19F4N2O+ and a molecular weight of 367.37 g/mol. Its IUPAC name is (3-fluorophenyl)-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | (3-fluorophenyl)-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 4755342 |
| Molecular Formula | C19H19F4N2O+ |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (3-fluorophenyl)-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | O=C(c1cccc(F)c1)N1CC[NH+](Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H18F4N2O/c20-17-3-1-2-15(12-17)18(26)25-10-8-24(9-11-25)13-14-4-6-16(7-5-14)19(21,22)23/h1-7,12H,8-11,13H2/p+1 |
| InChIKey | LIGSQNLZDSLOEO-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |