C20H22F3N2O2+ — CID 4754563
(3-methoxyphenyl)-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 4754563) has the molecular formula C20H22F3N2O2+ and a molecular weight of 379.40 g/mol. Its IUPAC name is (3-methoxyphenyl)-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 4754563 |
| Molecular Formula | C20H22F3N2O2+ |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (3-methoxyphenyl)-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CC[NH+](Cc3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H21F3N2O2/c1-27-18-4-2-3-16(13-18)19(26)25-11-9-24(10-12-25)14-15-5-7-17(8-6-15)20(21,22)23/h2-8,13H,9-12,14H2,1H3/p+1 |
| InChIKey | OWBAGEURYPKTLQ-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |