C17H27N2O2+ — CID 1398985
azepan-1-yl-[(3R)-1-(furan-2-ylmethyl)piperidin-1-ium-3-yl]methanone (PubChem CID 1398985) has the molecular formula C17H27N2O2+ and a molecular weight of 291.41 g/mol. Its IUPAC name is azepan-1-yl-[(3R)-1-(furan-2-ylmethyl)piperidin-1-ium-3-yl]methanone.
| Compound Name | azepan-1-yl-[(3R)-1-(furan-2-ylmethyl)piperidin-1-ium-3-yl]methanone |
|---|---|
| PubChem CID | 1398985 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | azepan-1-yl-[(3R)-1-(furan-2-ylmethyl)piperidin-1-ium-3-yl]methanone |
| SMILES | O=C([C@@H]1CCC[NH+](Cc2ccco2)C1)N1CCCCCC1 |
| InChI | InChI=1S/C17H26N2O2/c20-17(19-10-3-1-2-4-11-19)15-7-5-9-18(13-15)14-16-8-6-12-21-16/h6,8,12,15H,1-5,7,9-11,13-14H2/p+1/t15-/m1/s1 |
| InChIKey | WORFDAODWCDIGJ-OAHLLOKOSA-O |
| XLogP | 1.48 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |