C21H33N2O3+ — CID 7471877
[1-[(3-ethoxy-2-hydroxyphenyl)methyl]piperidin-1-ium-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone (PubChem CID 7471877) has the molecular formula C21H33N2O3+ and a molecular weight of 361.51 g/mol. Its IUPAC name is [1-[(3-ethoxy-2-hydroxyphenyl)methyl]piperidin-1-ium-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone.
| Compound Name | [1-[(3-ethoxy-2-hydroxyphenyl)methyl]piperidin-1-ium-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 7471877 |
| Molecular Formula | C21H33N2O3+ |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | [1-[(3-ethoxy-2-hydroxyphenyl)methyl]piperidin-1-ium-4-yl]-[(3R)-3-methylpiperidin-1-yl]methanone |
| SMILES | CCOc1cccc(C[NH+]2CCC(C(=O)N3CCC[C@@H](C)C3)CC2)c1O |
| InChI | InChI=1S/C21H32N2O3/c1-3-26-19-8-4-7-18(20(19)24)15-22-12-9-17(10-13-22)21(25)23-11-5-6-16(2)14-23/h4,7-8,16-17,24H,3,5-6,9-15H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | POKKKCMFBUUUDQ-MRXNPFEDSA-O |
| XLogP | 1.84 |
| TPSA | 54.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|