C19H27FN2O — CID 807250
[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-[(3S)-3-methylpiperidin-1-yl]methanone (PubChem CID 807250) has the molecular formula C19H27FN2O and a molecular weight of 318.44 g/mol. Its IUPAC name is [1-[(2-fluorophenyl)methyl]piperidin-4-yl]-[(3S)-3-methylpiperidin-1-yl]methanone.
| Compound Name | [1-[(2-fluorophenyl)methyl]piperidin-4-yl]-[(3S)-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 807250 |
| Molecular Formula | C19H27FN2O |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | [1-[(2-fluorophenyl)methyl]piperidin-4-yl]-[(3S)-3-methylpiperidin-1-yl]methanone |
| SMILES | C[C@H]1CCCN(C(=O)C2CCN(Cc3ccccc3F)CC2)C1 |
| InChI | InChI=1S/C19H27FN2O/c1-15-5-4-10-22(13-15)19(23)16-8-11-21(12-9-16)14-17-6-2-3-7-18(17)20/h2-3,6-7,15-16H,4-5,8-14H2,1H3/t15-/m0/s1 |
| InChIKey | XNPVBXLEWRYESJ-HNNXBMFYSA-N |
| XLogP | 3.30 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |