C22H32FN3O2 — CID 56742293
[1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 56742293) has the molecular formula C22H32FN3O2 and a molecular weight of 389.52 g/mol. Its IUPAC name is [1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 56742293 |
| Molecular Formula | C22H32FN3O2 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | [1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCCN(C2CCN(Cc3ccccc3F)CC2)C1)N1CCOCC1 |
| InChI | InChI=1S/C22H32FN3O2/c23-21-6-2-1-4-18(21)16-24-10-7-20(8-11-24)26-9-3-5-19(17-26)22(27)25-12-14-28-15-13-25/h1-2,4,6,19-20H,3,5,7-17H2 |
| InChIKey | OWCPJVOEFRJWMF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |