C22H31FN2O2 — CID 109149065
N-[2-(2-fluorophenyl)ethyl]-4-(3-methylpiperidine-1-carbonyl)cyclohexane-1-carboxamide (PubChem CID 109149065) has the molecular formula C22H31FN2O2 and a molecular weight of 374.50 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-4-(3-methylpiperidine-1-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-4-(3-methylpiperidine-1-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109149065 |
| Molecular Formula | C22H31FN2O2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-4-(3-methylpiperidine-1-carbonyl)cyclohexane-1-carboxamide |
| SMILES | CC1CCCN(C(=O)C2CCC(C(=O)NCCc3ccccc3F)CC2)C1 |
| InChI | InChI=1S/C22H31FN2O2/c1-16-5-4-14-25(15-16)22(27)19-10-8-18(9-11-19)21(26)24-13-12-17-6-2-3-7-20(17)23/h2-3,6-7,16,18-19H,4-5,8-15H2,1H3,(H,24,26) |
| InChIKey | SCBPUXJLQHSUFR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |