C17H23N3O4S — CID 17322160
4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-N-(2-methoxyethyl)piperazine-1-carbothioamide (PubChem CID 17322160) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-N-(2-methoxyethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-N-(2-methoxyethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17322160 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxine-3-carbonyl)-N-(2-methoxyethyl)piperazine-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCN(C(=O)C2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C17H23N3O4S/c1-22-11-6-18-17(25)20-9-7-19(8-10-20)16(21)15-12-23-13-4-2-3-5-14(13)24-15/h2-5,15H,6-12H2,1H3,(H,18,25) |
| InChIKey | OKRYGMUXJHGEAK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|